C21H30O2S2 — CID 88792862
(8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,3'-dithiolane]-17-one (PubChem CID 88792862) has the molecular formula C21H30O2S2 and a molecular weight of 378.60 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,3'-dithiolane]-17-one.
| Compound Name | (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,3'-dithiolane]-17-one |
|---|---|
| PubChem CID | 88792862 |
| Molecular Formula | C21H30O2S2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,3'-dithiolane]-17-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC5(CCSS5)CC[C@@]43CO)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H30O2S2/c1-19-7-6-17-15(16(19)4-5-18(19)23)3-2-14-12-20(10-11-24-25-20)8-9-21(14,17)13-22/h12,15-17,22H,2-11,13H2,1H3/t15-,16-,17-,19-,20?,21+/m0/s1 |
| InChIKey | FKJOQURMIAQQSU-ZYZNDRNLSA-N |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|