C16H24O5 — CID 88794707
methyl (E)-7-[(1R,2S,5S)-2-acetyloxy-5-formylcyclopentyl]hept-2-enoate (PubChem CID 88794707) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl (E)-7-[(1R,2S,5S)-2-acetyloxy-5-formylcyclopentyl]hept-2-enoate.
| Compound Name | methyl (E)-7-[(1R,2S,5S)-2-acetyloxy-5-formylcyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 88794707 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl (E)-7-[(1R,2S,5S)-2-acetyloxy-5-formylcyclopentyl]hept-2-enoate |
| SMILES | COC(=O)/C=C/CCCC[C@H]1[C@@H](OC(C)=O)CC[C@@H]1C=O |
| InChI | InChI=1S/C16H24O5/c1-12(18)21-15-10-9-13(11-17)14(15)7-5-3-4-6-8-16(19)20-2/h6,8,11,13-15H,3-5,7,9-10H2,1-2H3/b8-6+/t13-,14-,15+/m1/s1 |
| InChIKey | MEQKZHIYOOKKSK-OUONAIIESA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|