C14H14N2OS2 — CID 88794818
S-(pyridin-3-ylmethyl) N-(4-methylsulfanylphenyl)carbamothioate (PubChem CID 88794818) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is S-(pyridin-3-ylmethyl) N-(4-methylsulfanylphenyl)carbamothioate.
| Compound Name | S-(pyridin-3-ylmethyl) N-(4-methylsulfanylphenyl)carbamothioate |
|---|---|
| PubChem CID | 88794818 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | S-(pyridin-3-ylmethyl) N-(4-methylsulfanylphenyl)carbamothioate |
| SMILES | CSc1ccc(NC(=O)SCc2cccnc2)cc1 |
| InChI | InChI=1S/C14H14N2OS2/c1-18-13-6-4-12(5-7-13)16-14(17)19-10-11-3-2-8-15-9-11/h2-9H,10H2,1H3,(H,16,17) |
| InChIKey | RSFXNYZCFGZORN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|