About calcium chloromethanesulfonate
calcium chloromethanesulfonate (PubChem CID 88795152) has the molecular formula C2H4CaCl2O6S2
and a molecular weight of 299.17 g/mol. Its IUPAC name is calcium chloromethanesulfonate.
Molecular Properties
| Compound Name | calcium chloromethanesulfonate |
| PubChem CID | 88795152 |
| Molecular Formula | C2H4CaCl2O6S2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 297.85 |
| IUPAC Name | calcium chloromethanesulfonate |
| SMILES | O=S(=O)([O-])CCl.O=S(=O)([O-])CCl.[Ca+2] |
| InChI | InChI=1S/2CH3ClO3S.Ca/c2*2-1-6(3,4)5;/h2*1H2,(H,3,4,5);/q;;+2/p-2 |
| InChIKey | MBRFXWLDNCUGJI-UHFFFAOYSA-L |
| XLogP | -0.93 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze calcium chloromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium chloromethanesulfonate?
The IUPAC name of calcium chloromethanesulfonate (CID 88795152) is calcium chloromethanesulfonate.
What is the SMILES notation for calcium chloromethanesulfonate?
The canonical SMILES for calcium chloromethanesulfonate is O=S(=O)([O-])CCl.O=S(=O)([O-])CCl.[Ca+2].
What is the InChIKey of calcium chloromethanesulfonate?
The InChIKey is MBRFXWLDNCUGJI-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH3ClO3S.Ca/c2*2-1-6(3,4)5;/h2*1H2,(H,3,4,5);/q;;+2/p-2.
What are the key properties of calcium chloromethanesulfonate?
calcium chloromethanesulfonate has a molecular weight of 299.17 g/mol, XLogP of -0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium chloromethanesulfonate is sourced from PubChem (CID 88795152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).