C15H13NO4S2 — CID 88797043
(5R)-3-(2-benzoylsulfanylethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 88797043) has the molecular formula C15H13NO4S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (5R)-3-(2-benzoylsulfanylethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R)-3-(2-benzoylsulfanylethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88797043 |
| Molecular Formula | C15H13NO4S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (5R)-3-(2-benzoylsulfanylethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(CCSC(=O)c2ccccc2)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C15H13NO4S2/c17-11-8-12-16(11)13(14(18)19)10(22-12)6-7-21-15(20)9-4-2-1-3-5-9/h1-5,12H,6-8H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | PFUOAGCUMACUCU-GFCCVEGCSA-N |
| XLogP | 2.55 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|