C9H20O6S — CID 88797471
3-[2,2-bis(hydroxymethyl)butoxy]propane-1-sulfonic acid (PubChem CID 88797471) has the molecular formula C9H20O6S and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-[2,2-bis(hydroxymethyl)butoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2,2-bis(hydroxymethyl)butoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88797471 |
| Molecular Formula | C9H20O6S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-[2,2-bis(hydroxymethyl)butoxy]propane-1-sulfonic acid |
| SMILES | CCC(CO)(CO)COCCCS(=O)(=O)O |
| InChI | InChI=1S/C9H20O6S/c1-2-9(6-10,7-11)8-15-4-3-5-16(12,13)14/h10-11H,2-8H2,1H3,(H,12,13,14) |
| InChIKey | IBCBYMJILAZWAQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|