C16H11Cl2NO5S — CID 88797719
N,2-dichloro-5-(7-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide (PubChem CID 88797719) has the molecular formula C16H11Cl2NO5S and a molecular weight of 400.24 g/mol. Its IUPAC name is N,2-dichloro-5-(7-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide.
| Compound Name | N,2-dichloro-5-(7-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 88797719 |
| Molecular Formula | C16H11Cl2NO5S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | N,2-dichloro-5-(7-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide |
| SMILES | COc1cccc2cc(C(=O)c3ccc(Cl)c(S(=O)(=O)NCl)c3)oc12 |
| InChI | InChI=1S/C16H11Cl2NO5S/c1-23-12-4-2-3-10-7-13(24-16(10)12)15(20)9-5-6-11(17)14(8-9)25(21,22)19-18/h2-8,19H,1H3 |
| InChIKey | QVRZYYMYWSZXHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|