C16H12ClNO5S — CID 21316621
2-chloro-5-(6-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide (PubChem CID 21316621) has the molecular formula C16H12ClNO5S and a molecular weight of 365.79 g/mol. Its IUPAC name is 2-chloro-5-(6-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(6-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21316621 |
| Molecular Formula | C16H12ClNO5S |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-chloro-5-(6-methoxy-1-benzofuran-2-carbonyl)benzenesulfonamide |
| SMILES | COc1ccc2cc(C(=O)c3ccc(Cl)c(S(N)(=O)=O)c3)oc2c1 |
| InChI | InChI=1S/C16H12ClNO5S/c1-22-11-4-2-9-6-14(23-13(9)8-11)16(19)10-3-5-12(17)15(7-10)24(18,20)21/h2-8H,1H3,(H2,18,20,21) |
| InChIKey | YWBQVYNPUXYBDL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |