C18H17NO4 — CID 88798697
methyl 2-[(2,2-diphenylacetyl)amino]-3-oxopropanoate (PubChem CID 88798697) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 2-[(2,2-diphenylacetyl)amino]-3-oxopropanoate.
| Compound Name | methyl 2-[(2,2-diphenylacetyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 88798697 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 2-[(2,2-diphenylacetyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)C(C=O)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c1-23-18(22)15(12-20)19-17(21)16(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15-16H,1H3,(H,19,21) |
| InChIKey | HQRDQOJLQCYSBK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|