C22H36O2 — CID 88800887
(8S,9R,10S,13S,14S)-17-hydroxy-4,6,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 88800887) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-17-hydroxy-4,6,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (8S,9R,10S,13S,14S)-17-hydroxy-4,6,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 88800887 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (8S,9R,10S,13S,14S)-17-hydroxy-4,6,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CC1CCC[C@@]2(C=O)C1C(C)C[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(C)O |
| InChI | InChI=1S/C22H36O2/c1-14-6-5-9-22(13-23)18-7-10-20(3)17(8-11-21(20,4)24)16(18)12-15(2)19(14)22/h13-19,24H,5-12H2,1-4H3/t14?,15?,16-,17-,18+,19?,20-,21?,22-/m0/s1 |
| InChIKey | JMLXCHVPGILQCE-HADDEDOMSA-N |
| XLogP | 4.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|