C19H29BrO3 — CID 134871891
(1S,5S,5aS,9aR,11aS)-5-bromo-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydroindeno[5,4-f]chromen-7-one (PubChem CID 134871891) has the molecular formula C19H29BrO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is (1S,5S,5aS,9aR,11aS)-5-bromo-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydroindeno[5,4-f]chromen-7-one.
| Compound Name | (1S,5S,5aS,9aR,11aS)-5-bromo-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydroindeno[5,4-f]chromen-7-one |
|---|---|
| PubChem CID | 134871891 |
| Molecular Formula | C19H29BrO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (1S,5S,5aS,9aR,11aS)-5-bromo-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydroindeno[5,4-f]chromen-7-one |
| SMILES | C[C@]1(O)CCC2C3C[C@H](Br)[C@H]4OC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C19H29BrO3/c1-17-7-6-15(21)23-16(17)14(20)10-11-12(17)4-8-18(2)13(11)5-9-19(18,3)22/h11-14,16,22H,4-10H2,1-3H3/t11?,12?,13?,14-,16+,17+,18-,19-/m0/s1 |
| InChIKey | ZUIGZKIOHUNINA-RUEHEMNASA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|