About dibromonickel;bis(tri(propan-2-yl)phosphane)
dibromonickel;bis(tri(propan-2-yl)phosphane) (PubChem CID 88800949) has the molecular formula C18H42Br2NiP2
and a molecular weight of 538.98 g/mol. Its IUPAC name is dibromonickel;bis(tri(propan-2-yl)phosphane).
Molecular Properties
| Compound Name | dibromonickel;bis(tri(propan-2-yl)phosphane) |
| PubChem CID | 88800949 |
| Molecular Formula | C18H42Br2NiP2 |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | dibromonickel;bis(tri(propan-2-yl)phosphane) |
| SMILES | Br[Ni]Br.CC(C)P(C(C)C)C(C)C.CC(C)P(C(C)C)C(C)C |
| InChI | InChI=1S/2C9H21P.2BrH.Ni/c2*1-7(2)10(8(3)4)9(5)6;;;/h2*7-9H,1-6H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | APLALGPCNLPRBC-UHFFFAOYSA-L |
| XLogP | 9.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibromonickel;bis(tri(propan-2-yl)phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromonickel;bis(tri(propan-2-yl)phosphane)?
The IUPAC name of dibromonickel;bis(tri(propan-2-yl)phosphane) (CID 88800949) is dibromonickel;bis(tri(propan-2-yl)phosphane).
What is the SMILES notation for dibromonickel;bis(tri(propan-2-yl)phosphane)?
The canonical SMILES for dibromonickel;bis(tri(propan-2-yl)phosphane) is Br[Ni]Br.CC(C)P(C(C)C)C(C)C.CC(C)P(C(C)C)C(C)C.
What is the InChIKey of dibromonickel;bis(tri(propan-2-yl)phosphane)?
The InChIKey is APLALGPCNLPRBC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H21P.2BrH.Ni/c2*1-7(2)10(8(3)4)9(5)6;;;/h2*7-9H,1-6H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dibromonickel;bis(tri(propan-2-yl)phosphane)?
dibromonickel;bis(tri(propan-2-yl)phosphane) has a molecular weight of 538.98 g/mol, XLogP of 9.08, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromonickel;bis(tri(propan-2-yl)phosphane) is sourced from PubChem (CID 88800949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).