About palladium;prop-1-ene;tri(propan-2-yl)phosphane
palladium;prop-1-ene;tri(propan-2-yl)phosphane (PubChem CID 87969772) has the molecular formula C12H26PPd-
and a molecular weight of 307.73 g/mol. Its IUPAC name is palladium;prop-1-ene;tri(propan-2-yl)phosphane.
Molecular Properties
| Compound Name | palladium;prop-1-ene;tri(propan-2-yl)phosphane |
| PubChem CID | 87969772 |
| Molecular Formula | C12H26PPd- |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | palladium;prop-1-ene;tri(propan-2-yl)phosphane |
| SMILES | C=C[CH2-].CC(C)P(C(C)C)C(C)C.[Pd] |
| InChI | InChI=1S/C9H21P.C3H5.Pd/c1-7(2)10(8(3)4)9(5)6;1-3-2;/h7-9H,1-6H3;3H,1-2H2;/q;-1; |
| InChIKey | CTDLZQCWRCJHRE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;prop-1-ene;tri(propan-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;prop-1-ene;tri(propan-2-yl)phosphane?
The IUPAC name of palladium;prop-1-ene;tri(propan-2-yl)phosphane (CID 87969772) is palladium;prop-1-ene;tri(propan-2-yl)phosphane.
What is the SMILES notation for palladium;prop-1-ene;tri(propan-2-yl)phosphane?
The canonical SMILES for palladium;prop-1-ene;tri(propan-2-yl)phosphane is C=C[CH2-].CC(C)P(C(C)C)C(C)C.[Pd].
What is the InChIKey of palladium;prop-1-ene;tri(propan-2-yl)phosphane?
The InChIKey is CTDLZQCWRCJHRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21P.C3H5.Pd/c1-7(2)10(8(3)4)9(5)6;1-3-2;/h7-9H,1-6H3;3H,1-2H2;/q;-1;.
What are the key properties of palladium;prop-1-ene;tri(propan-2-yl)phosphane?
palladium;prop-1-ene;tri(propan-2-yl)phosphane has a molecular weight of 307.73 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;prop-1-ene;tri(propan-2-yl)phosphane is sourced from PubChem (CID 87969772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).