C29H26N4O6S2 — CID 88803576
benzhydryl (6R)-3-[(E)-(acetylhydrazinylidene)methyl]-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88803576) has the molecular formula C29H26N4O6S2 and a molecular weight of 590.68 g/mol. Its IUPAC name is benzhydryl (6R)-3-[(E)-(acetylhydrazinylidene)methyl]-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-[(E)-(acetylhydrazinylidene)methyl]-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88803576 |
| Molecular Formula | C29H26N4O6S2 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | benzhydryl (6R)-3-[(E)-(acetylhydrazinylidene)methyl]-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)N/N=C/C1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)Cc3cccs3)[C@H]2S(=O)C1 |
| InChI | InChI=1S/C29H26N4O6S2/c1-18(34)32-30-16-21-17-41(38)28-24(31-23(35)15-22-13-8-14-40-22)27(36)33(28)25(21)29(37)39-26(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-14,16,24,26,28H,15,17H2,1H3,(H,31,35)(H,32,34)/b30-16+/t24?,28-,41?/m1/s1 |
| InChIKey | PBOAVOPQBPVALS-XCSDMTCESA-N |
| XLogP | 2.41 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|