C16H17N3O6S2 — CID 131710496
(6R)-3-(ethoxyiminomethyl)-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 131710496) has the molecular formula C16H17N3O6S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is (6R)-3-(ethoxyiminomethyl)-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-(ethoxyiminomethyl)-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131710496 |
| Molecular Formula | C16H17N3O6S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (6R)-3-(ethoxyiminomethyl)-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=CC1=C(C(=O)O)N2C(=O)C(NC(=O)Cc3cccs3)[C@H]2S(=O)C1 |
| InChI | InChI=1S/C16H17N3O6S2/c1-2-25-17-7-9-8-27(24)15-12(14(21)19(15)13(9)16(22)23)18-11(20)6-10-4-3-5-26-10/h3-5,7,12,15H,2,6,8H2,1H3,(H,18,20)(H,22,23)/t12?,15-,27?/m1/s1 |
| InChIKey | OJGPZWNNUQJTMT-KTMOLCFISA-N |
| XLogP | 0.07 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|