C19H19N3O7S — CID 88820322
(6R,7R)-7-[[2-(2-carboxyphenyl)acetyl]amino]-3-[(E)-ethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88820322) has the molecular formula C19H19N3O7S and a molecular weight of 433.44 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-carboxyphenyl)acetyl]amino]-3-[(E)-ethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[2-(2-carboxyphenyl)acetyl]amino]-3-[(E)-ethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88820322 |
| Molecular Formula | C19H19N3O7S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (6R,7R)-7-[[2-(2-carboxyphenyl)acetyl]amino]-3-[(E)-ethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCO/N=C/C1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)Cc3ccccc3C(=O)O)[C@H]2SC1 |
| InChI | InChI=1S/C19H19N3O7S/c1-2-29-20-8-11-9-30-17-14(16(24)22(17)15(11)19(27)28)21-13(23)7-10-5-3-4-6-12(10)18(25)26/h3-6,8,14,17H,2,7,9H2,1H3,(H,21,23)(H,25,26)(H,27,28)/b20-8+/t14-,17-/m1/s1 |
| InChIKey | SXNXRFFMZOUVMG-MPZNYJKTSA-N |
| XLogP | 0.69 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|