C21H18N4O6S — CID 88820416
(6S,7R)-7-[(1-methyl-6-oxopyridine-3-carbonyl)amino]-8-oxo-3-(phenoxyiminomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88820416) has the molecular formula C21H18N4O6S and a molecular weight of 454.46 g/mol. Its IUPAC name is (6S,7R)-7-[(1-methyl-6-oxopyridine-3-carbonyl)amino]-8-oxo-3-(phenoxyiminomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-[(1-methyl-6-oxopyridine-3-carbonyl)amino]-8-oxo-3-(phenoxyiminomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88820416 |
| Molecular Formula | C21H18N4O6S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (6S,7R)-7-[(1-methyl-6-oxopyridine-3-carbonyl)amino]-8-oxo-3-(phenoxyiminomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cn1cc(C(=O)N[C@@H]2C(=O)N3C(C(=O)O)=C(C=NOc4ccccc4)CS[C@@H]23)ccc1=O |
| InChI | InChI=1S/C21H18N4O6S/c1-24-10-12(7-8-15(24)26)18(27)23-16-19(28)25-17(21(29)30)13(11-32-20(16)25)9-22-31-14-5-3-2-4-6-14/h2-10,16,20H,11H2,1H3,(H,23,27)(H,29,30)/t16-,20+/m1/s1 |
| InChIKey | WSGMOSBUVPRRKB-UZLBHIALSA-N |
| XLogP | 0.80 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|