About N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide
N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide (PubChem CID 88806123) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide |
| PubChem CID | 88806123 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide |
| SMILES | CC(=O)NC1(O)N2C(=O)C[C@H]2SC1(C)C |
| InChI | InChI=1S/C9H14N2O3S/c1-5(12)10-9(14)8(2,3)15-7-4-6(13)11(7)9/h7,14H,4H2,1-3H3,(H,10,12)/t7-,9?/m1/s1 |
| InChIKey | KUZJQQXQISBYIB-YOXFSPIKSA-N |
| XLogP | -0.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide?
The IUPAC name of N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide (CID 88806123) is N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide.
What is the SMILES notation for N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide?
The canonical SMILES for N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide is CC(=O)NC1(O)N2C(=O)C[C@H]2SC1(C)C.
What is the InChIKey of N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide?
The InChIKey is KUZJQQXQISBYIB-YOXFSPIKSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-5(12)10-9(14)8(2,3)15-7-4-6(13)11(7)9/h7,14H,4H2,1-3H3,(H,10,12)/t7-,9?/m1/s1.
What are the key properties of N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide?
N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide has a molecular weight of 230.29 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5R)-2-hydroxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]acetamide is sourced from PubChem (CID 88806123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).