C23H30O3S2 — CID 88806443
1-phenylethyl 3,5-ditert-butyl-4-hydroxy-2,6-bis(sulfanyl)benzoate (PubChem CID 88806443) has the molecular formula C23H30O3S2 and a molecular weight of 418.62 g/mol. Its IUPAC name is 1-phenylethyl 3,5-ditert-butyl-4-hydroxy-2,6-bis(sulfanyl)benzoate.
| Compound Name | 1-phenylethyl 3,5-ditert-butyl-4-hydroxy-2,6-bis(sulfanyl)benzoate |
|---|---|
| PubChem CID | 88806443 |
| Molecular Formula | C23H30O3S2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-phenylethyl 3,5-ditert-butyl-4-hydroxy-2,6-bis(sulfanyl)benzoate |
| SMILES | CC(OC(=O)c1c(S)c(C(C)(C)C)c(O)c(C(C)(C)C)c1S)c1ccccc1 |
| InChI | InChI=1S/C23H30O3S2/c1-13(14-11-9-8-10-12-14)26-21(25)15-19(27)16(22(2,3)4)18(24)17(20(15)28)23(5,6)7/h8-13,24,27-28H,1-7H3 |
| InChIKey | BAYRKKBQAZJPFH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|