About aluminum;chloro phosphate;ethanolate
aluminum;chloro phosphate;ethanolate (PubChem CID 88806976) has the molecular formula C2H5AlClO5P
and a molecular weight of 202.47 g/mol. Its IUPAC name is aluminum;chloro phosphate;ethanolate.
Molecular Properties
| Compound Name | aluminum;chloro phosphate;ethanolate |
| PubChem CID | 88806976 |
| Molecular Formula | C2H5AlClO5P |
| Molecular Weight | 202.47 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | aluminum;chloro phosphate;ethanolate |
| SMILES | CC[O-].O=P([O-])([O-])OCl.[Al+3] |
| InChI | InChI=1S/C2H5O.Al.ClH2O4P/c1-2-3;;1-5-6(2,3)4/h2H2,1H3;;(H2,2,3,4)/q-1;+3;/p-2 |
| InChIKey | ACCJXIXRZYGYJP-UHFFFAOYSA-L |
| XLogP | -2.03 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.47 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aluminum;chloro phosphate;ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;chloro phosphate;ethanolate?
The IUPAC name of aluminum;chloro phosphate;ethanolate (CID 88806976) is aluminum;chloro phosphate;ethanolate.
What is the SMILES notation for aluminum;chloro phosphate;ethanolate?
The canonical SMILES for aluminum;chloro phosphate;ethanolate is CC[O-].O=P([O-])([O-])OCl.[Al+3].
What is the InChIKey of aluminum;chloro phosphate;ethanolate?
The InChIKey is ACCJXIXRZYGYJP-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H5O.Al.ClH2O4P/c1-2-3;;1-5-6(2,3)4/h2H2,1H3;;(H2,2,3,4)/q-1;+3;/p-2.
What are the key properties of aluminum;chloro phosphate;ethanolate?
aluminum;chloro phosphate;ethanolate has a molecular weight of 202.47 g/mol, XLogP of -2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;chloro phosphate;ethanolate is sourced from PubChem (CID 88806976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).