About (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt
(2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt (PubChem CID 88808342) has the molecular formula C21H41CoNO3S
and a molecular weight of 446.56 g/mol. Its IUPAC name is (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt.
Molecular Properties
| Compound Name | (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt |
| PubChem CID | 88808342 |
| Molecular Formula | C21H41CoNO3S |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(=O)C(N)CCSC.[Co] |
| InChI | InChI=1S/C21H41NO3S.Co/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)25-21(24)19(22)17-18-26-2;/h19H,3-18,22H2,1-2H3; |
| InChIKey | ZRFQXKRFBNOCLZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt?
The IUPAC name of (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt (CID 88808342) is (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt.
What is the SMILES notation for (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt?
The canonical SMILES for (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt is CCCCCCCCCCCCCCCC(=O)OC(=O)C(N)CCSC.[Co].
What is the InChIKey of (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt?
The InChIKey is ZRFQXKRFBNOCLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41NO3S.Co/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)25-21(24)19(22)17-18-26-2;/h19H,3-18,22H2,1-2H3;.
What are the key properties of (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt?
(2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt has a molecular weight of 446.56 g/mol, XLogP of 5.62, 18 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-methylsulfanylbutanoyl) hexadecanoate;cobalt is sourced from PubChem (CID 88808342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).