C12H16N2O7S — CID 88811205
(6R)-3-(acetyloxymethyl)-7-formamido-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88811205) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is (6R)-3-(acetyloxymethyl)-7-formamido-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-3-(acetyloxymethyl)-7-formamido-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88811205 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (6R)-3-(acetyloxymethyl)-7-formamido-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | COC1(NC=O)C(=O)N2CC(COC(C)=O)(C(=O)O)CS[C@@H]21 |
| InChI | InChI=1S/C12H16N2O7S/c1-7(16)21-4-11(10(18)19)3-14-8(17)12(20-2,13-6-15)9(14)22-5-11/h6,9H,3-5H2,1-2H3,(H,13,15)(H,18,19)/t9-,11?,12?/m1/s1 |
| InChIKey | RTJIIKFXYPQZEJ-OIKLOGQESA-N |
| XLogP | -1.38 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|