C17H20N4O8S2 — CID 88683629
(6R)-3-(acetyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-methoxyamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88683629) has the molecular formula C17H20N4O8S2 and a molecular weight of 472.50 g/mol. Its IUPAC name is (6R)-3-(acetyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-methoxyamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-3-(acetyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-methoxyamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88683629 |
| Molecular Formula | C17H20N4O8S2 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | (6R)-3-(acetyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]-methoxyamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CON(C(=O)Cc1csc(NC=O)n1)C1C(=O)N2CC(COC(C)=O)(C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C17H20N4O8S2/c1-9(23)29-6-17(15(26)27)5-20-13(25)12(14(20)31-7-17)21(28-2)11(24)3-10-4-30-16(19-10)18-8-22/h4,8,12,14H,3,5-7H2,1-2H3,(H,26,27)(H,18,19,22)/t12?,14-,17?/m1/s1 |
| InChIKey | CPQSSUREOYTYOX-KDJCLPLCSA-N |
| XLogP | -0.44 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|