C8H14FNO3 — CID 88811352
ethyl (3Z)-4-fluoro-3-hydroxyimino-2,2-dimethylbutanoate (PubChem CID 88811352) has the molecular formula C8H14FNO3 and a molecular weight of 191.20 g/mol. Its IUPAC name is ethyl (3Z)-4-fluoro-3-hydroxyimino-2,2-dimethylbutanoate.
| Compound Name | ethyl (3Z)-4-fluoro-3-hydroxyimino-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 88811352 |
| Molecular Formula | C8H14FNO3 |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | ethyl (3Z)-4-fluoro-3-hydroxyimino-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)/C(CF)=N/O |
| InChI | InChI=1S/C8H14FNO3/c1-4-13-7(11)8(2,3)6(5-9)10-12/h12H,4-5H2,1-3H3/b10-6+ |
| InChIKey | KETZYWHBFPXHFQ-UXBLZVDNSA-N |
| XLogP | 1.38 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|