About calcium;dodecyl sulfate;octadecanoate
calcium;dodecyl sulfate;octadecanoate (PubChem CID 88811506) has the molecular formula C30H60CaO6S
and a molecular weight of 588.95 g/mol. Its IUPAC name is calcium;dodecyl sulfate;octadecanoate.
Molecular Properties
| Compound Name | calcium;dodecyl sulfate;octadecanoate |
| PubChem CID | 88811506 |
| Molecular Formula | C30H60CaO6S |
| Molecular Weight | 588.95 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | calcium;dodecyl sulfate;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCOS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C18H36O2.C12H26O4S.Ca/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h2-17H2,1H3,(H,19,20);2-12H2,1H3,(H,13,14,15);/q;;+2/p-2 |
| InChIKey | PLXDYHGHFPFACH-UHFFFAOYSA-L |
| XLogP | 8.00 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.95 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium;dodecyl sulfate;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;dodecyl sulfate;octadecanoate?
The IUPAC name of calcium;dodecyl sulfate;octadecanoate (CID 88811506) is calcium;dodecyl sulfate;octadecanoate.
What is the SMILES notation for calcium;dodecyl sulfate;octadecanoate?
The canonical SMILES for calcium;dodecyl sulfate;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCOS(=O)(=O)[O-].[Ca+2].
What is the InChIKey of calcium;dodecyl sulfate;octadecanoate?
The InChIKey is PLXDYHGHFPFACH-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H36O2.C12H26O4S.Ca/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h2-17H2,1H3,(H,19,20);2-12H2,1H3,(H,13,14,15);/q;;+2/p-2.
What are the key properties of calcium;dodecyl sulfate;octadecanoate?
calcium;dodecyl sulfate;octadecanoate has a molecular weight of 588.95 g/mol, XLogP of 8.00, 28 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;dodecyl sulfate;octadecanoate is sourced from PubChem (CID 88811506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).