C14H15N3O7S — CID 88811720
(6S)-7-[acetyl(cyano)amino]-3-(acetyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88811720) has the molecular formula C14H15N3O7S and a molecular weight of 369.36 g/mol. Its IUPAC name is (6S)-7-[acetyl(cyano)amino]-3-(acetyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[acetyl(cyano)amino]-3-(acetyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88811720 |
| Molecular Formula | C14H15N3O7S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | (6S)-7-[acetyl(cyano)amino]-3-(acetyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1(N(C#N)C(C)=O)C(=O)N2C(C(=O)O)=C(COC(C)=O)CS[C@H]21 |
| InChI | InChI=1S/C14H15N3O7S/c1-7(18)16(6-15)14(23-3)12(22)17-10(11(20)21)9(4-24-8(2)19)5-25-13(14)17/h13H,4-5H2,1-3H3,(H,20,21)/t13-,14?/m0/s1 |
| InChIKey | QSBAZDCJHUTZSW-LSLKUGRBSA-N |
| XLogP | -0.52 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|