About carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol
carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol (PubChem CID 88813503) has the molecular formula C6H14ClO6P
and a molecular weight of 248.60 g/mol. Its IUPAC name is carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol.
Molecular Properties
| Compound Name | carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol |
| PubChem CID | 88813503 |
| Molecular Formula | C6H14ClO6P |
| Molecular Weight | 248.60 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol |
| SMILES | CCOP(=O)(CC)OCO.O=C(O)Cl |
| InChI | InChI=1S/C5H13O4P.CHClO2/c1-3-8-10(7,4-2)9-5-6;2-1(3)4/h6H,3-5H2,1-2H3;(H,3,4) |
| InChIKey | RXGPUQGEVIEJTE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol?
The IUPAC name of carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol (CID 88813503) is carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol.
What is the SMILES notation for carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol?
The canonical SMILES for carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol is CCOP(=O)(CC)OCO.O=C(O)Cl.
What is the InChIKey of carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol?
The InChIKey is RXGPUQGEVIEJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13O4P.CHClO2/c1-3-8-10(7,4-2)9-5-6;2-1(3)4/h6H,3-5H2,1-2H3;(H,3,4).
What are the key properties of carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol?
carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol has a molecular weight of 248.60 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonochloridic acid;[ethoxy(ethyl)phosphoryl]oxymethanol is sourced from PubChem (CID 88813503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).