C20H40N4O4 — CID 88814635
(2S)-2-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(pentylamino)butanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanamide (PubChem CID 88814635) has the molecular formula C20H40N4O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(pentylamino)butanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(pentylamino)butanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 88814635 |
| Molecular Formula | C20H40N4O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(pentylamino)butanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanamide |
| SMILES | CCCCCNC(C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(N)=O)C(C)C)[C@@H](C)O |
| InChI | InChI=1S/C20H40N4O4/c1-7-8-9-10-22-17(14(6)25)20(28)24-16(13(4)5)19(27)23-15(18(21)26)11-12(2)3/h12-17,22,25H,7-11H2,1-6H3,(H2,21,26)(H,23,27)(H,24,28)/t14-,15+,16+,17?/m1/s1 |
| InChIKey | ZLKZQACPCVMMTQ-WTYVYLTKSA-N |
| XLogP | 0.67 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|