N-(fluoromethyl)-N-methylcarbamoyl chloride

C3H5ClFNO — CID 88816847

IUPACN-(fluoromethyl)-N-methylcarbamoyl chloride
SMILESCN(CF)C(=O)Cl
InChIInChI=1S/C3H5ClFNO/c1-6(2-5)3(4)7/h2H2,1H3
InChIKeyGOVGHVDJXBFYND-UHFFFAOYSA-N
MW125.53 g/mol
LogP1.20
Rot. Bonds1

About N-(fluoromethyl)-N-methylcarbamoyl chloride

N-(fluoromethyl)-N-methylcarbamoyl chloride (PubChem CID 88816847) has the molecular formula C3H5ClFNO and a molecular weight of 125.53 g/mol. Its IUPAC name is N-(fluoromethyl)-N-methylcarbamoyl chloride.

Molecular Properties

Compound NameN-(fluoromethyl)-N-methylcarbamoyl chloride
PubChem CID88816847
Molecular FormulaC3H5ClFNO
Molecular Weight125.53 g/mol
Exact Mass125.00
IUPAC NameN-(fluoromethyl)-N-methylcarbamoyl chloride
SMILESCN(CF)C(=O)Cl
InChIInChI=1S/C3H5ClFNO/c1-6(2-5)3(4)7/h2H2,1H3
InChIKeyGOVGHVDJXBFYND-UHFFFAOYSA-N
XLogP1.20
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500125.53
LogP ≤ 51.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-(fluoromethyl)-N-methylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(fluoromethyl)-N-methylcarbamoyl chloride?
The IUPAC name of N-(fluoromethyl)-N-methylcarbamoyl chloride (CID 88816847) is N-(fluoromethyl)-N-methylcarbamoyl chloride.
What is the SMILES notation for N-(fluoromethyl)-N-methylcarbamoyl chloride?
The canonical SMILES for N-(fluoromethyl)-N-methylcarbamoyl chloride is CN(CF)C(=O)Cl.
What is the InChIKey of N-(fluoromethyl)-N-methylcarbamoyl chloride?
The InChIKey is GOVGHVDJXBFYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClFNO/c1-6(2-5)3(4)7/h2H2,1H3.
What are the key properties of N-(fluoromethyl)-N-methylcarbamoyl chloride?
N-(fluoromethyl)-N-methylcarbamoyl chloride has a molecular weight of 125.53 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(fluoromethyl)-N-methylcarbamoyl chloride is sourced from PubChem (CID 88816847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).