About (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate
(2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate (PubChem CID 8881767) has the molecular formula C21H14ClNO6
and a molecular weight of 411.80 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate.
Molecular Properties
| Compound Name | (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate |
| PubChem CID | 8881767 |
| Molecular Formula | C21H14ClNO6 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)Oc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H14ClNO6/c22-18-12-16(23(26)27)8-11-19(18)29-20(24)13-28-17-9-6-15(7-10-17)21(25)14-4-2-1-3-5-14/h1-12H,13H2 |
| InChIKey | GWPVAPYKYOFING-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate?
The IUPAC name of (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate (CID 8881767) is (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate.
What is the SMILES notation for (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate?
The canonical SMILES for (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate is O=C(COc1ccc(C(=O)c2ccccc2)cc1)Oc1ccc([N+](=O)[O-])cc1Cl.
What is the InChIKey of (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate?
The InChIKey is GWPVAPYKYOFING-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14ClNO6/c22-18-12-16(23(26)27)8-11-19(18)29-20(24)13-28-17-9-6-15(7-10-17)21(25)14-4-2-1-3-5-14/h1-12H,13H2.
What are the key properties of (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate?
(2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate has a molecular weight of 411.80 g/mol, XLogP of 4.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-nitrophenyl) 2-(4-benzoylphenoxy)acetate is sourced from PubChem (CID 8881767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).