C29H38O6 — CID 88818034
[2-[(8S,9S,10R,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-15,16-dimethylidene-3-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] hexanoate (PubChem CID 88818034) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-15,16-dimethylidene-3-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] hexanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-15,16-dimethylidene-3-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] hexanoate |
|---|---|
| PubChem CID | 88818034 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-15,16-dimethylidene-3-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] hexanoate |
| SMILES | C=C1C(=C)[C@](O)(C(=O)COC(=O)CCCCC)[C@@]2(C)CC(O)[C@H]3[C@@H](CCC4=CC(=O)C=C[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C29H38O6/c1-6-7-8-9-24(33)35-16-23(32)29(34)18(3)17(2)25-21-11-10-19-14-20(30)12-13-27(19,4)26(21)22(31)15-28(25,29)5/h12-14,21-22,25-26,31,34H,2-3,6-11,15-16H2,1,4-5H3/t21-,22?,25-,26+,27-,28-,29-/m0/s1 |
| InChIKey | OPRRQWDBZVFERX-CCCTYBJKSA-N |
| XLogP | 4.02 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|