C41H62O7 — CID 25015111
[2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] (E)-hexadec-9-enoate (PubChem CID 25015111) has the molecular formula C41H62O7 and a molecular weight of 666.94 g/mol. Its IUPAC name is [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] (E)-hexadec-9-enoate.
| Compound Name | [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] (E)-hexadec-9-enoate |
|---|---|
| PubChem CID | 25015111 |
| Molecular Formula | C41H62O7 |
| Molecular Weight | 666.94 g/mol |
| Exact Mass | 666.45 |
| IUPAC Name | [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] (E)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)OCC(=O)C12OC(CCC)OC1CC1C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C41H62O7/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-20-36(45)46-28-34(44)41-35(47-37(48-41)19-6-2)26-32-31-22-21-29-25-30(42)23-24-39(29,3)38(31)33(43)27-40(32,41)4/h11-12,23-25,31-33,35,37-38,43H,5-10,13-22,26-28H2,1-4H3/b12-11+ |
| InChIKey | XCVHCHACOCREHY-VAWYXSNFSA-N |
| XLogP | 8.52 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.94 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|