C55H93NO10 — CID 177352814
[2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-diheptoxyhexyl(4-hydroxybutyl)amino]hexanoate (PubChem CID 177352814) has the molecular formula C55H93NO10 and a molecular weight of 928.35 g/mol. Its IUPAC name is [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-diheptoxyhexyl(4-hydroxybutyl)amino]hexanoate.
| Compound Name | [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-diheptoxyhexyl(4-hydroxybutyl)amino]hexanoate |
|---|---|
| PubChem CID | 177352814 |
| Molecular Formula | C55H93NO10 |
| Molecular Weight | 928.35 g/mol |
| Exact Mass | 927.68 |
| IUPAC Name | [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-diheptoxyhexyl(4-hydroxybutyl)amino]hexanoate |
| SMILES | CCCCCCCOC(CCCCCN(CCCCO)CCCCCC(=O)OCC(=O)C12OC(CCC)OC1CC1C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C)OCCCCCCC |
| InChI | InChI=1S/C55H93NO10/c1-6-9-11-13-23-36-62-50(63-37-24-14-12-10-7-2)27-18-16-20-33-56(34-21-22-35-57)32-19-15-17-26-49(61)64-41-47(60)55-48(65-51(66-55)25-8-3)39-45-44-29-28-42-38-43(58)30-31-53(42,4)52(44)46(59)40-54(45,55)5/h30-31,38,44-46,48,50-52,57,59H,6-29,32-37,39-41H2,1-5H3 |
| InChIKey | WUZXRLOJGQOBTM-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.35 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|