C53H89NO10 — CID 177352539
[2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-dihexoxyhexyl(4-hydroxybutyl)amino]hexanoate (PubChem CID 177352539) has the molecular formula C53H89NO10 and a molecular weight of 900.29 g/mol. Its IUPAC name is [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-dihexoxyhexyl(4-hydroxybutyl)amino]hexanoate.
| Compound Name | [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-dihexoxyhexyl(4-hydroxybutyl)amino]hexanoate |
|---|---|
| PubChem CID | 177352539 |
| Molecular Formula | C53H89NO10 |
| Molecular Weight | 900.29 g/mol |
| Exact Mass | 899.65 |
| IUPAC Name | [2-(11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-oxoethyl] 6-[6,6-dihexoxyhexyl(4-hydroxybutyl)amino]hexanoate |
| SMILES | CCCCCCOC(CCCCCN(CCCCO)CCCCCC(=O)OCC(=O)C12OC(CCC)OC1CC1C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C)OCCCCCC |
| InChI | InChI=1S/C53H89NO10/c1-6-9-11-21-34-60-48(61-35-22-12-10-7-2)25-16-14-18-31-54(32-19-20-33-55)30-17-13-15-24-47(59)62-39-45(58)53-46(63-49(64-53)23-8-3)37-43-42-27-26-40-36-41(56)28-29-51(40,4)50(42)44(57)38-52(43,53)5/h28-29,36,42-44,46,48-50,55,57H,6-27,30-35,37-39H2,1-5H3 |
| InChIKey | IJVLDZNRNIYSAX-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.29 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|