C43H66O7 — CID 91471973
[2-[(4R,8S)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] octadec-9-enoate (PubChem CID 91471973) has the molecular formula C43H66O7 and a molecular weight of 694.99 g/mol. Its IUPAC name is [2-[(4R,8S)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] octadec-9-enoate.
| Compound Name | [2-[(4R,8S)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] octadec-9-enoate |
|---|---|
| PubChem CID | 91471973 |
| Molecular Formula | C43H66O7 |
| Molecular Weight | 694.99 g/mol |
| Exact Mass | 694.48 |
| IUPAC Name | [2-[(4R,8S)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,18-dien-8-yl]-2-oxoethyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(=O)[C@@]12OC(CCC)O[C@@H]1CC1C3CC=C4CC(=O)C=CC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C43H66O7/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-38(47)48-30-36(46)43-37(49-39(50-43)21-6-2)28-34-33-24-23-31-27-32(44)25-26-41(31,3)40(33)35(45)29-42(34,43)4/h13-14,23,25-26,33-35,37,39-40,45H,5-12,15-22,24,27-30H2,1-4H3/t33?,34?,35?,37-,39?,40?,41?,42?,43-/m1/s1 |
| InChIKey | IZQXEBOBAGOGRF-FASSJMEDSA-N |
| XLogP | 9.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.99 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|