C31H48O5 — CID 88818549
[(1R,3Z,5S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-5-hydroxy-2-methylidenecyclohexyl] acetate (PubChem CID 88818549) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is [(1R,3Z,5S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-5-hydroxy-2-methylidenecyclohexyl] acetate.
| Compound Name | [(1R,3Z,5S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-5-hydroxy-2-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 88818549 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | [(1R,3Z,5S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-5-hydroxy-2-methylidenecyclohexyl] acetate |
| SMILES | C=C1/C(=C\C=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CCCC(C)C)C[C@](O)(OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H48O5/c1-20(2)10-8-11-21(3)27-15-16-28-25(12-9-17-30(27,28)7)13-14-26-18-31(34,36-24(6)33)19-29(22(26)4)35-23(5)32/h13-14,20-21,27-29,34H,4,8-12,15-19H2,1-3,5-7H3/b25-13?,26-14-/t21-,27-,28?,29-,30-,31+/m1/s1 |
| InChIKey | TYIRRATXCZPUPW-CHCCJUJPSA-N |
| XLogP | 7.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|