C29H48O2 — CID 143507070
(5E)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethyl-4-methylidenecyclohexane-1,1-diol (PubChem CID 143507070) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (5E)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethyl-4-methylidenecyclohexane-1,1-diol.
| Compound Name | (5E)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethyl-4-methylidenecyclohexane-1,1-diol |
|---|---|
| PubChem CID | 143507070 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (5E)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethyl-4-methylidenecyclohexane-1,1-diol |
| SMILES | C=C1/C(=C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]23)CC(O)(O)C(C)C1C |
| InChI | InChI=1S/C29H48O2/c1-19(2)10-8-11-20(3)26-15-16-27-24(12-9-17-28(26,27)7)13-14-25-18-29(30,31)23(6)21(4)22(25)5/h13-14,19-21,23,26-27,30-31H,5,8-12,15-18H2,1-4,6-7H3/b24-13+,25-14+/t20-,21?,23?,26-,27+,28-/m1/s1 |
| InChIKey | FMIWGZXCMJVYMW-UGGVTCOBSA-N |
| XLogP | 7.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|