C22H31N3O3S — CID 8881990
[(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 8881990) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8881990 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1nn(C)c(C)c1NC(=O)[C@@H](C)OC(=O)c1cc2c(s1)CC[C@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C22H31N3O3S/c1-12-19(13(2)25(7)24-12)23-20(26)14(3)28-21(27)18-11-15-10-16(22(4,5)6)8-9-17(15)29-18/h11,14,16H,8-10H2,1-7H3,(H,23,26)/t14-,16+/m1/s1 |
| InChIKey | AXKZRIBYKWQRGG-ZBFHGGJFSA-N |
| XLogP | 4.43 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |