C25H52O10 — CID 88821065
bis(1-(2-hexoxyethoxy)ethanol);pentanedioic acid (PubChem CID 88821065) has the molecular formula C25H52O10 and a molecular weight of 512.68 g/mol. Its IUPAC name is bis(1-(2-hexoxyethoxy)ethanol);pentanedioic acid.
| Compound Name | bis(1-(2-hexoxyethoxy)ethanol);pentanedioic acid |
|---|---|
| PubChem CID | 88821065 |
| Molecular Formula | C25H52O10 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.36 |
| IUPAC Name | bis(1-(2-hexoxyethoxy)ethanol);pentanedioic acid |
| SMILES | CCCCCCOCCOC(C)O.CCCCCCOCCOC(C)O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/2C10H22O3.C5H8O4/c2*1-3-4-5-6-7-12-8-9-13-10(2)11;6-4(7)2-1-3-5(8)9/h2*10-11H,3-9H2,1-2H3;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | VPPDWFCSHIAHAA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|