C9H18N4S2 — CID 88822040
1,1-dimethyl-3-[methyl(pyrrolidin-1-yl)carbamothioyl]thiourea (PubChem CID 88822040) has the molecular formula C9H18N4S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1,1-dimethyl-3-[methyl(pyrrolidin-1-yl)carbamothioyl]thiourea.
| Compound Name | 1,1-dimethyl-3-[methyl(pyrrolidin-1-yl)carbamothioyl]thiourea |
|---|---|
| PubChem CID | 88822040 |
| Molecular Formula | C9H18N4S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,1-dimethyl-3-[methyl(pyrrolidin-1-yl)carbamothioyl]thiourea |
| SMILES | CN(C)C(=S)NC(=S)N(C)N1CCCC1 |
| InChI | InChI=1S/C9H18N4S2/c1-11(2)8(14)10-9(15)12(3)13-6-4-5-7-13/h4-7H2,1-3H3,(H,10,14,15) |
| InChIKey | LAQADGVMRCAKGF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|