C19H23ClN4OS — CID 88823678
6-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenylpyrazine-2-carbothioamide (PubChem CID 88823678) has the molecular formula C19H23ClN4OS and a molecular weight of 390.94 g/mol. Its IUPAC name is 6-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenylpyrazine-2-carbothioamide.
| Compound Name | 6-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenylpyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 88823678 |
| Molecular Formula | C19H23ClN4OS |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 6-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenylpyrazine-2-carbothioamide |
| SMILES | CCN1CCCC1CNC(=S)c1nc(Cl)c(-c2ccccc2)nc1OC |
| InChI | InChI=1S/C19H23ClN4OS/c1-3-24-11-7-10-14(24)12-21-19(26)16-18(25-2)23-15(17(20)22-16)13-8-5-4-6-9-13/h4-6,8-9,14H,3,7,10-12H2,1-2H3,(H,21,26) |
| InChIKey | SODYCLIEPWAQAT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|