C9H8N2O4 — CID 88824919
3,5-diformamidobenzoic acid (PubChem CID 88824919) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 3,5-diformamidobenzoic acid.
| Compound Name | 3,5-diformamidobenzoic acid |
|---|---|
| PubChem CID | 88824919 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3,5-diformamidobenzoic acid |
| SMILES | O=CNc1cc(NC=O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H8N2O4/c12-4-10-7-1-6(9(14)15)2-8(3-7)11-5-13/h1-5H,(H,10,12)(H,11,13)(H,14,15) |
| InChIKey | FBXKZJSSGYWYPG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|