C44H50NiO10 — CID 88825161
bis(2,6-ditert-butyl-4-(2-carboxyphenoxy)carbonylphenolate);nickel(2+) (PubChem CID 88825161) has the molecular formula C44H50NiO10 and a molecular weight of 797.57 g/mol. Its IUPAC name is bis(2,6-ditert-butyl-4-(2-carboxyphenoxy)carbonylphenolate);nickel(2+).
| Compound Name | bis(2,6-ditert-butyl-4-(2-carboxyphenoxy)carbonylphenolate);nickel(2+) |
|---|---|
| PubChem CID | 88825161 |
| Molecular Formula | C44H50NiO10 |
| Molecular Weight | 797.57 g/mol |
| Exact Mass | 796.28 |
| IUPAC Name | bis(2,6-ditert-butyl-4-(2-carboxyphenoxy)carbonylphenolate);nickel(2+) |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2ccccc2C(=O)O)cc(C(C)(C)C)c1[O-].CC(C)(C)c1cc(C(=O)Oc2ccccc2C(=O)O)cc(C(C)(C)C)c1[O-].[Ni+2] |
| InChI | InChI=1S/2C22H26O5.Ni/c2*1-21(2,3)15-11-13(12-16(18(15)23)22(4,5)6)20(26)27-17-10-8-7-9-14(17)19(24)25;/h2*7-12,23H,1-6H3,(H,24,25);/q;;+2/p-2 |
| InChIKey | XSMOAERZZGCCRF-UHFFFAOYSA-L |
| XLogP | 8.54 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.57 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|