C21H21Cl3N2O5S — CID 88826548
tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-chloro-7-[[chloro-(3-chlorophenyl)methylidene]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88826548) has the molecular formula C21H21Cl3N2O5S and a molecular weight of 519.83 g/mol. Its IUPAC name is tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-chloro-7-[[chloro-(3-chlorophenyl)methylidene]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-chloro-7-[[chloro-(3-chlorophenyl)methylidene]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88826548 |
| Molecular Formula | C21H21Cl3N2O5S |
| Molecular Weight | 519.83 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | tert-butyl (6R,7S)-3-(acetyloxymethyl)-7-chloro-7-[[chloro-(3-chlorophenyl)methylidene]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(C)(C)C)N2C(=O)[C@@](Cl)(N=C(Cl)c3cccc(Cl)c3)[C@H]2SC1 |
| InChI | InChI=1S/C21H21Cl3N2O5S/c1-11(27)30-9-13-10-32-19-21(24,25-16(23)12-6-5-7-14(22)8-12)18(29)26(19)15(13)17(28)31-20(2,3)4/h5-8,19H,9-10H2,1-4H3/t19-,21-/m1/s1 |
| InChIKey | BMKBWMNBNVEVKM-TZIWHRDSSA-N |
| XLogP | 4.33 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|