About [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate
[dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate (PubChem CID 88826560) has the molecular formula C22H40N2O5Sn2
and a molecular weight of 649.99 g/mol. Its IUPAC name is [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate.
Molecular Properties
| Compound Name | [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate |
| PubChem CID | 88826560 |
| Molecular Formula | C22H40N2O5Sn2 |
| Molecular Weight | 649.99 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)CC#N)O[Sn](CCCC)(CCCC)OC(=O)CC#N |
| InChI | InChI=1S/4C4H9.2C3H3NO2.O.2Sn/c4*1-3-4-2;2*4-2-1-3(5)6;;;/h4*1,3-4H2,2H3;2*1H2,(H,5,6);;;/q;;;;;;;2*+1/p-2 |
| InChIKey | YFTQCLCWEOCODQ-UHFFFAOYSA-L |
| XLogP | 6.00 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 649.99 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate?
The IUPAC name of [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate (CID 88826560) is [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate.
What is the SMILES notation for [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate?
The canonical SMILES for [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate is CCCC[Sn](CCCC)(OC(=O)CC#N)O[Sn](CCCC)(CCCC)OC(=O)CC#N.
What is the InChIKey of [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate?
The InChIKey is YFTQCLCWEOCODQ-UHFFFAOYSA-L. The full InChI is InChI=1S/4C4H9.2C3H3NO2.O.2Sn/c4*1-3-4-2;2*4-2-1-3(5)6;;;/h4*1,3-4H2,2H3;2*1H2,(H,5,6);;;/q;;;;;;;2*+1/p-2.
What are the key properties of [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate?
[dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate has a molecular weight of 649.99 g/mol, XLogP of 6.00, 18 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [dibutyl-[dibutyl-(2-cyanoacetyl)oxystannyl]oxystannyl] 2-cyanoacetate is sourced from PubChem (CID 88826560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).