C17H10N2Na2O9S2 — CID 88829538
disodium;4-[(3-nitrobenzoyl)amino]naphthalene-2,7-disulfonate (PubChem CID 88829538) has the molecular formula C17H10N2Na2O9S2 and a molecular weight of 496.39 g/mol. Its IUPAC name is disodium;4-[(3-nitrobenzoyl)amino]naphthalene-2,7-disulfonate.
| Compound Name | disodium;4-[(3-nitrobenzoyl)amino]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 88829538 |
| Molecular Formula | C17H10N2Na2O9S2 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | disodium;4-[(3-nitrobenzoyl)amino]naphthalene-2,7-disulfonate |
| SMILES | O=C(Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])ccc12)c1cccc([N+](=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C17H12N2O9S2.2Na/c20-17(10-2-1-3-12(6-10)19(21)22)18-16-9-14(30(26,27)28)8-11-7-13(29(23,24)25)4-5-15(11)16;;/h1-9H,(H,18,20)(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2 |
| InChIKey | ZAFIOPVNQMCXJG-UHFFFAOYSA-L |
| XLogP | -4.18 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|