C20H25N2O3S+ — CID 88831026
hydroxy-dimethyl-[2-[6-[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrrolo[2,1-b][1,3]thiazol-3-yl]acetyl]azanium (PubChem CID 88831026) has the molecular formula C20H25N2O3S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is hydroxy-dimethyl-[2-[6-[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrrolo[2,1-b][1,3]thiazol-3-yl]acetyl]azanium.
| Compound Name | hydroxy-dimethyl-[2-[6-[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrrolo[2,1-b][1,3]thiazol-3-yl]acetyl]azanium |
|---|---|
| PubChem CID | 88831026 |
| Molecular Formula | C20H25N2O3S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | hydroxy-dimethyl-[2-[6-[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrrolo[2,1-b][1,3]thiazol-3-yl]acetyl]azanium |
| SMILES | CC(C)(C)Oc1ccc(-c2cc3scc(CC(=O)[N+](C)(C)O)n3c2)cc1 |
| InChI | InChI=1S/C20H25N2O3S/c1-20(2,3)25-17-8-6-14(7-9-17)15-10-18-21(12-15)16(13-26-18)11-19(23)22(4,5)24/h6-10,12-13,24H,11H2,1-5H3/q+1 |
| InChIKey | HSMRSXNHINBITJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|