About 2-aminobutyl N-hydroxybenzenecarboximidothioate
2-aminobutyl N-hydroxybenzenecarboximidothioate (PubChem CID 88836511) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-aminobutyl N-hydroxybenzenecarboximidothioate.
Molecular Properties
| Compound Name | 2-aminobutyl N-hydroxybenzenecarboximidothioate |
| PubChem CID | 88836511 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-aminobutyl N-hydroxybenzenecarboximidothioate |
| SMILES | CCC(N)CSC(=NO)c1ccccc1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-10(12)8-15-11(13-14)9-6-4-3-5-7-9/h3-7,10,14H,2,8,12H2,1H3 |
| InChIKey | BJGIXKAAPMUHGX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutyl N-hydroxybenzenecarboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutyl N-hydroxybenzenecarboximidothioate?
The IUPAC name of 2-aminobutyl N-hydroxybenzenecarboximidothioate (CID 88836511) is 2-aminobutyl N-hydroxybenzenecarboximidothioate.
What is the SMILES notation for 2-aminobutyl N-hydroxybenzenecarboximidothioate?
The canonical SMILES for 2-aminobutyl N-hydroxybenzenecarboximidothioate is CCC(N)CSC(=NO)c1ccccc1.
What is the InChIKey of 2-aminobutyl N-hydroxybenzenecarboximidothioate?
The InChIKey is BJGIXKAAPMUHGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-2-10(12)8-15-11(13-14)9-6-4-3-5-7-9/h3-7,10,14H,2,8,12H2,1H3.
What are the key properties of 2-aminobutyl N-hydroxybenzenecarboximidothioate?
2-aminobutyl N-hydroxybenzenecarboximidothioate has a molecular weight of 224.33 g/mol, XLogP of 2.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutyl N-hydroxybenzenecarboximidothioate is sourced from PubChem (CID 88836511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).