About 6-propoxyhept-1-en-3-one;hydrate
6-propoxyhept-1-en-3-one;hydrate (PubChem CID 88846119) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-propoxyhept-1-en-3-one;hydrate.
Molecular Properties
| Compound Name | 6-propoxyhept-1-en-3-one;hydrate |
| PubChem CID | 88846119 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 6-propoxyhept-1-en-3-one;hydrate |
| SMILES | C=CC(=O)CCC(C)OCCC.O |
| InChI | InChI=1S/C10H18O2.H2O/c1-4-8-12-9(3)6-7-10(11)5-2;/h5,9H,2,4,6-8H2,1,3H3;1H2 |
| InChIKey | AHLXGUGJFXSXSF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-propoxyhept-1-en-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propoxyhept-1-en-3-one;hydrate?
The IUPAC name of 6-propoxyhept-1-en-3-one;hydrate (CID 88846119) is 6-propoxyhept-1-en-3-one;hydrate.
What is the SMILES notation for 6-propoxyhept-1-en-3-one;hydrate?
The canonical SMILES for 6-propoxyhept-1-en-3-one;hydrate is C=CC(=O)CCC(C)OCCC.O.
What is the InChIKey of 6-propoxyhept-1-en-3-one;hydrate?
The InChIKey is AHLXGUGJFXSXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.H2O/c1-4-8-12-9(3)6-7-10(11)5-2;/h5,9H,2,4,6-8H2,1,3H3;1H2.
What are the key properties of 6-propoxyhept-1-en-3-one;hydrate?
6-propoxyhept-1-en-3-one;hydrate has a molecular weight of 188.27 g/mol, XLogP of 1.51, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propoxyhept-1-en-3-one;hydrate is sourced from PubChem (CID 88846119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).