C34H33FN4O4S — CID 88852953
N-[3-[3-(3-fluoropiperidin-1-yl)propyl]-2-hydroxyphenyl]-3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-4-sulfanylidene-3H-pyridine-5-carboxamide (PubChem CID 88852953) has the molecular formula C34H33FN4O4S and a molecular weight of 612.73 g/mol. Its IUPAC name is N-[3-[3-(3-fluoropiperidin-1-yl)propyl]-2-hydroxyphenyl]-3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-4-sulfanylidene-3H-pyridine-5-carboxamide.
| Compound Name | N-[3-[3-(3-fluoropiperidin-1-yl)propyl]-2-hydroxyphenyl]-3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-4-sulfanylidene-3H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 88852953 |
| Molecular Formula | C34H33FN4O4S |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | N-[3-[3-(3-fluoropiperidin-1-yl)propyl]-2-hydroxyphenyl]-3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-4-sulfanylidene-3H-pyridine-5-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(C#CC2C=NC=C(C(=O)Nc3cccc(CCCN4CCCC(F)C4)c3O)C2=S)c1 |
| InChI | InChI=1S/C34H33FN4O4S/c1-22-14-17-43-31(22)34(42)37-27-10-2-6-23(18-27)12-13-25-19-36-20-28(32(25)44)33(41)38-29-11-3-7-24(30(29)40)8-4-15-39-16-5-9-26(35)21-39/h2-3,6-7,10-11,14,17-20,25-26,40H,4-5,8-9,15-16,21H2,1H3,(H,37,42)(H,38,41) |
| InChIKey | HPQVCFMYRCMARI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|